25917-89-9 Usage
Uses
Used in Dye Industry:
4-Amino-3-nitro-6-methylaniline is used as a dye intermediate for the production of various dyes, including hair dyes and textile dyes. Its chemical structure allows for the synthesis of a wide range of colored compounds, making it a valuable component in the creation of vibrant and long-lasting dyes.
Used in Pharmaceutical Industry:
4-Amino-3-nitro-6-methylaniline is used as a starting material for the synthesis of certain pharmaceutical compounds due to its unique chemical properties. Its reactivity and functional groups enable the development of new drugs with potential therapeutic applications.
Used in Antimicrobial Applications:
4-Amino-3-nitro-6-methylaniline exhibits antimicrobial properties, making it useful in applications where the inhibition of microbial growth is required. Its ability to target and disrupt microbial cells can be harnessed in the development of antimicrobial agents for various industries, including healthcare and food preservation.
Used in Antifungal Applications:
Due to its antifungal properties, 4-Amino-3-nitro-6-methylaniline can be employed in the development of antifungal agents. Its effectiveness against fungal pathogens can be utilized in various settings, such as agriculture to protect crops and in medical applications to treat fungal infections.
Safety Precautions:
It is crucial to handle 4-Amino-3-nitro-6-methylaniline with care, as it may pose health risks if ingested, inhaled, or absorbed through the skin. It can cause skin and eye irritation, and proper safety measures should be taken during its use and storage to minimize potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 25917-89-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,9,1 and 7 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 25917-89:
(7*2)+(6*5)+(5*9)+(4*1)+(3*7)+(2*8)+(1*9)=139
139 % 10 = 9
So 25917-89-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O2/c1-4-2-6(9)7(10(11)12)3-5(4)8/h2-3H,8-9H2,1H3
