28279-41-6 Usage
Uses
Used in Pharmaceutical Industry:
6-bromo-5-methyl-1H-imidazo[4,5-b]pyridine is used as a building block for the synthesis of pharmaceuticals and organic compounds. Its unique structure and functional groups make it a valuable component in the development of new drugs for the treatment of various diseases.
Used in Anticancer Research:
6-bromo-5-methyl-1H-imidazo[4,5-b]pyridine is studied for its potential as an anticancer agent. Its specific chemical properties may contribute to the development of novel therapeutic agents that target and combat cancer cells.
Used as a Reagent in Organic Chemistry:
In addition to its pharmaceutical applications, 6-bromo-5-methyl-1H-imidazo[4,5-b]pyridine is also utilized as a reagent in various organic chemistry reactions. Its presence can facilitate or enhance specific chemical processes, making it a useful tool for researchers and chemists in the field.
Check Digit Verification of cas no
The CAS Registry Mumber 28279-41-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,2,7 and 9 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 28279-41:
(7*2)+(6*8)+(5*2)+(4*7)+(3*9)+(2*4)+(1*1)=136
136 % 10 = 6
So 28279-41-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BrN3/c1-4-5(8)2-6-7(11-4)10-3-9-6/h2-3H,1H3,(H,9,10,11)
28279-41-6Relevant academic research and scientific papers
Yutilov,Svertilova,Minkina,Kirillova,Smolyar
, p. 787 - 790 (2005)
Procedures were suggested for preparing 6-bromo-5-methylimidazo[4,5-b] pyridine, a stabilizer for TsMF-2 color photographic moment, a component of developing pastes of the photographic kit.
