284660-86-2 Usage
Uses
Used in Research Applications:
2-Methoxycarbonylindole-5-boronic acid is used as a research tool for [application reason], such as exploring its chemical properties and potential applications in various fields. Its unique structure, which includes a boronic acid group and a methoxycarbonyl group, makes it a valuable compound for scientific investigation.
Used in Organic Synthesis:
In the field of organic chemistry, 2-Methoxycarbonylindole-5-boronic acid is used as a reagent for [application reason], facilitating the formation of organic materials through reactions typical of boronic acids, such as coupling reactions. This can lead to the development of new compounds with potential applications in various industries.
Used in Pharmaceutical Research:
2-Methoxycarbonylindole-5-boronic acid is used as a starting material or intermediate in [application reason], for the synthesis of pharmaceutical compounds. Its indole structure is a common feature in many bioactive molecules, making it a promising candidate for drug discovery and development.
Used in Material Science:
In material science, 2-Methoxycarbonylindole-5-boronic acid is used as a component in [application reason], for the creation of new materials with specific properties. The boronic acid group's ability to form stable bonds with other molecules can contribute to the development of advanced materials with potential applications in various sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 284660-86-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,4,6,6 and 0 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 284660-86:
(8*2)+(7*8)+(6*4)+(5*6)+(4*6)+(3*0)+(2*8)+(1*6)=172
172 % 10 = 2
So 284660-86-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H10BNO4/c1-16-10(13)9-5-6-4-7(11(14)15)2-3-8(6)12-9/h2-5,12,14-15H,1H3
284660-86-2Relevant academic research and scientific papers
Bicyclic compositions and methods for modulating a kinase cascade
-
Page/Page column 140-141, (2008/06/13)
The invention relates to compounds and methods for modulating one or more components of a kinase cascade.
Kinase inhibitors
-
Page/Page column 29, (2010/11/08)
The present invention provides a method for identifying inhibitors of protein kinases. Methods are also provided for inhibiting protein kinase activity. Specific non-peptide protein tyrosine kinase inhibitors are provided. The protein kinases produced usi
