306934-76-9 Usage
Description
5-METHYL-6-PHENYLTHIENO[2,3-D]PYRIMIDIN-4-OL is a chemical compound with the molecular formula C13H10N2OS, belonging to the class of organic compounds known as phenylthiophenes. It features a thieno[2,3-d]pyrimidin-4-ol backbone with a methyl group at the 5-position and a phenyl group at the 6-position. 5-METHYL-6-PHENYLTHIENO[2,3-D]PYRIMIDIN-4-OL is of interest in medicinal chemistry due to its potential pharmacological properties and is being studied for its possible use as a drug target in treating various diseases and disorders.
Uses
As the exact uses and potential applications of 5-METHYL-6-PHENYLTHIENO[2,3-D]PYRIMIDIN-4-OL are still under investigation, the following applications are based on its potential pharmacological properties and interest in medicinal chemistry:
Used in Pharmaceutical Industry:
5-METHYL-6-PHENYLTHIENO[2,3-D]PYRIMIDIN-4-OL is used as a potential drug target for the development of new therapeutic agents. Its unique chemical structure and properties make it a promising candidate for the treatment of various diseases and disorders.
Used in Medicinal Chemistry Research:
5-METHYL-6-PHENYLTHIENO[2,3-D]PYRIMIDIN-4-OL is utilized as a subject of study in medicinal chemistry to explore its pharmacological properties and potential interactions with biological targets. This research aims to understand its mechanism of action and identify its potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 306934-76-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,9,3 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 306934-76:
(8*3)+(7*0)+(6*6)+(5*9)+(4*3)+(3*4)+(2*7)+(1*6)=149
149 % 10 = 9
So 306934-76-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H10N2OS/c1-8-10-12(16)14-7-15-13(10)17-11(8)9-5-3-2-4-6-9/h2-7H,1H3,(H,14,15,16)
306934-76-9Relevant articles and documents
Thieno[2,3-d]pyrimidines as antagonists of the glutamate receptors
Briel,Rybak,Kronbach,Unverferth
experimental part, p. 823 - 826 (2009/04/10)
Although the function of the kainate receptors in the brain is still not clear, they are increasingly defined as targets in the development of new classes of anti-epileptics. The thienopyrimidines described in this report were tested for their antagonisti
