3128-15-2 Usage
Uses
Used in Organic Synthesis:
Cyclopentene-1,2-dicarboxylic acid is used as a key intermediate in the synthesis of various organic molecules and polymers. Its unique structure allows for a wide range of chemical reactions, making it a valuable component in organic synthesis.
Used in Pharmaceutical Industry:
Cyclopentene-1,2-dicarboxylic acid is used as a building block for the development of pharmaceutical compounds. Its potential applications in this industry include the creation of new drugs and the improvement of existing ones, thanks to its ability to form diverse chemical structures.
Used in Agrochemical Industry:
In the agrochemical sector, cyclopentene-1,2-dicarboxylic acid is utilized as a precursor for the synthesis of various agrochemicals. Its role in this industry is crucial for the development of new pesticides, herbicides, and other agricultural chemicals.
Used in Materials Science:
Cyclopentene-1,2-dicarboxylic acid is employed as a component in the development of advanced materials. Its properties contribute to the creation of materials with unique characteristics, such as improved strength, flexibility, or chemical resistance.
Used in Industrial Processes:
As a key intermediate, cyclopentene-1,2-dicarboxylic acid plays an important role in various industrial processes. Its versatility and reactivity make it a valuable asset in the production of a range of chemical compounds, contributing to the efficiency and effectiveness of these processes.
Check Digit Verification of cas no
The CAS Registry Mumber 3128-15-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,1,2 and 8 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3128-15:
(6*3)+(5*1)+(4*2)+(3*8)+(2*1)+(1*5)=62
62 % 10 = 2
So 3128-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O4/c8-6(9)4-2-1-3-5(4)7(10)11/h1-3H2,(H,8,9)(H,10,11)
3128-15-2Relevant academic research and scientific papers
Thioalkanoylalkanoic acid compounds
-
, (2008/06/13)
Thioalkanoylalkanoic acid compounds and salts thereof having the formula STR1 wherein R 1, R 2, R 3 and R 4 each is hydrogen or lower alkyl;R 5 is hydrogen, lower alkanoyl, benzoyl or STR2 A and B each is hydrogen or join together as a polymethylene chain --(CH 2) n -- to complete a 4-, 5- or 6- membered cycloalkyl group, and m is 0 or 1,are angiotensin converting enzyme inhibitors and are useful as hypotensive agents.
