propane-1,2,3-triol triformate is a chemical with a specific purpose. Lookchem provides you with multiple data and supplier information of this chemical.

32765-69-8

Post Buying Request

Basic information
1. Product Name: propane-1,2,3-triol triformate
2. Synonyms: propane-1,2,3-triol triformate;Glycerol TriforMate, Technical Grade;UFTFJSFQGQCHQW-UHFFFAOYSA-N
3. CAS NO:32765-69-8
4. Molecular Formula: C₆H₈O₆
5. Molecular Weight: 176.12412
6. EINECS: N/A
7. Product Categories: Aliphatics, Pharmaceuticals, Intermediates & Fine Chemicals
8. Mol File: 32765-69-8.mol
Chemical Properties
1. Melting Point: 18 °C
2. Boiling Point: 291.5°C at 760 mmHg
3. Flash Point: 128.9°C
4. Appearance: /
5. Density: 1.267g/cm³
6. Vapor Pressure: 0.00194mmHg at 25°C
7. Refractive Index: 1.425
8. Storage Temp.: N/A
9. Solubility: N/A
10. CAS DataBase Reference: propane-1,2,3-triol triformate(CAS DataBase Reference)
11. NIST Chemistry Reference: propane-1,2,3-triol triformate(32765-69-8)
12. EPA Substance Registry System: propane-1,2,3-triol triformate(32765-69-8)
Safety Data
1. Hazard Codes: N/A
2. Statements: N/A
3. Safety Statements: N/A
4. WGK Germany:
5. RTECS:
6. HazardClass: N/A
7. PackingGroup: N/A
8. Hazardous Substances Data: 32765-69-8(Hazardous Substances Data)

Suppliers
Usage
Synthetic route
Upstream product
Downstream Products

32765-69-8 Suppliers

Recommended suppliers

32765-69-8 Usage

Uses

Glycerol Triformate is a potential oviposition inducers for corn earworm.

Check Digit Verification of cas no

The CAS Registry Mumber 32765-69-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,7,6 and 5 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 32765-69:
(7*3)+(6*2)+(5*7)+(4*6)+(3*5)+(2*6)+(1*9)=128
128 % 10 = 8
So 32765-69-8 is a valid CAS Registry Number.

InChI:InChI=1/C6H8O6/c7-3-10-1-6(12-5-9)2-11-4-8/h3-6H,1-2H2