34014-51-2 Usage
Uses
Used in Pharmaceutical Industry:
1-OXO-1,2-DIHYDRO-4-ISOQUINOLINECARBOXYLIC ACID is used as a Kv1.3 potassium shaker channel blocker for its potential therapeutic applications in various diseases. Kv1.3 potassium channels play a crucial role in the immune system, particularly in the activation and function of T-cells. By blocking these channels, the compound can modulate the immune response and potentially be used in the treatment of autoimmune diseases, inflammatory conditions, and other immune-related disorders.
Used in Research and Development:
1-OXO-1,2-DIHYDRO-4-ISOQUINOLINECARBOXYLIC ACID can also be utilized in research and development for the discovery of new drugs and therapies. Its unique structure and biological activities make it a valuable tool for studying the mechanisms of various diseases and for identifying potential drug targets. Additionally, it can be used as a starting point for the synthesis of new compounds with improved properties and applications.
Used in Drug Delivery Systems:
Similar to gallotannin, 1-OXO-1,2-DIHYDRO-4-ISOQUINOLINECARBOXYLIC ACID can be incorporated into drug delivery systems to enhance its bioavailability, delivery, and therapeutic outcomes. Various organic and metallic nanoparticles can be employed as carriers for 1-OXO-1,2-DIHYDRO-4-ISOQUINOLINECARBOXYLIC ACID, allowing for targeted and controlled release of the active ingredient. This approach can improve the overall efficacy of the compound and reduce potential side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 34014-51-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,0,1 and 4 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 34014-51:
(7*3)+(6*4)+(5*0)+(4*1)+(3*4)+(2*5)+(1*1)=72
72 % 10 = 2
So 34014-51-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H7NO3/c12-9-7-4-2-1-3-6(7)8(5-11-9)10(13)14/h1-5H,(H,11,12)(H,13,14)
