3594-37-4 Usage
Uses
Used in Pharmaceutical Synthesis:
3-Acetoacetylpyridine is utilized as a catalyst in the synthesis of pharmaceuticals, where it accelerates various chemical reactions. Its efficiency in catalyzing organic transformations is pivotal in the production of a range of medicinal compounds, thereby contributing to the advancement of drug discovery and development.
Used in Agrochemical Production:
In the agrochemical industry, 3-Acetoacetylpyridine serves as a catalyst for chemical reactions involved in the synthesis of crop protection agents and other agricultural chemicals. Its ability to expedite organic reactions is crucial for the production of effective and sustainable agrochemicals that protect crops and enhance agricultural productivity.
Used in Material Science:
3-Acetoacetylpyridine is also explored for its potential applications in material science. It is studied for its role in the development of new materials, where its catalytic properties can be harnessed to create innovative substances with unique properties and applications.
Used in Specialty Chemicals Production:
Furthermore, 3-Acetoacetylpyridine is employed as a component in the production of specialty chemicals. Its involvement in the synthesis of these high-value chemicals underscores its importance in various industrial applications, including but not limited to coatings, adhesives, and fragrances.
Check Digit Verification of cas no
The CAS Registry Mumber 3594-37-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,5,9 and 4 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 3594-37:
(6*3)+(5*5)+(4*9)+(3*4)+(2*3)+(1*7)=104
104 % 10 = 4
So 3594-37-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H9NO2/c1-7(11)5-9(12)8-3-2-4-10-6-8/h2-4,6H,5H2,1H3