3916-39-0 Usage
General Description
Z-GLY-GLU-OH is a chemical compound that consists of three amino acids - glycine, glutamic acid, and a hydroxyl group. The Z in the name indicates that the molecule has a specific configuration around the peptide bond. Z-GLY-GLU-OH is often used in the field of biochemistry and pharmaceutical research for its potential as a building block in the synthesis of peptides and proteins. It can also serve as a starting material for the creation of new drugs or pharmaceutical compounds. Additionally, Z-GLY-GLU-OH has been studied for its potential involvement in the regulation of physiological processes such as cell signaling and protein structure. Overall, this compound has important applications in various areas of scientific research and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 3916-39-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,9,1 and 6 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 3916-39:
(6*3)+(5*9)+(4*1)+(3*6)+(2*3)+(1*9)=100
100 % 10 = 0
So 3916-39-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N2O7/c18-12(17-11(14(21)22)6-7-13(19)20)8-16-15(23)24-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,16,23)(H,17,18)(H,19,20)(H,21,22)