40784-95-0 Usage
General Description
(4-isobutylphenyl)acetonitrile is a chemical compound with the molecular formula C14H15N. It is a colorless liquid that is mainly used as an intermediate in the production of pharmaceuticals, perfumes, and other organic compounds. (4-isobutylphenyl)acetonitrile is also known for its potential use as a building block in the synthesis of various organic molecules, thanks to its reactive nature and ability to act as a precursor for other chemical reactions. Additionally, it is considered to be a versatile compound in organic chemistry due to its unique chemical properties and its ability to participate in a variety of chemical transformations. Overall, (4-isobutylphenyl)acetonitrile has found widespread use in the chemical industry as an important starting material for the synthesis of a wide range of organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 40784-95-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,7,8 and 4 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 40784-95:
(7*4)+(6*0)+(5*7)+(4*8)+(3*4)+(2*9)+(1*5)=130
130 % 10 = 0
So 40784-95-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N/c1-10(2)9-12-5-3-11(4-6-12)7-8-13/h3-6,10H,7,9H2,1-2H3