41404-63-1 Usage
Uses
Used in Research Applications:
2-Bromo-4,6-Difluoro-Pyridine is used as a chemical intermediate for the synthesis of various complex organic molecules and pharmaceutical compounds. Its unique structure and reactivity make it a valuable building block in the development of new drugs and materials.
Used in Chemical Synthesis:
In the field of organic chemistry, 2-Bromo-4,6-Difluoro-Pyridine is employed as a key reactant in the preparation of a wide range of chemical products. Its versatility in undergoing various chemical reactions, such as substitution, addition, and elimination, allows for the creation of diverse molecules with potential applications in different industries.
Used in Pharmaceutical Development:
2-Bromo-4,6-Difluoro-Pyridine is utilized as a starting material in the synthesis of novel pharmaceutical agents. Its presence in the molecular structure can impart specific biological activities, such as antimicrobial, antiviral, or anticancer properties, which can be further optimized through medicinal chemistry approaches.
Used in Material Science:
In the realm of material science, 2-Bromo-4,6-Difluoro-Pyridine is explored for its potential applications in the development of advanced materials, such as polymers, coatings, and sensors. Its incorporation into these materials can lead to improved properties, such as enhanced stability, selectivity, or responsiveness to environmental stimuli.
Check Digit Verification of cas no
The CAS Registry Mumber 41404-63-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,4,0 and 4 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 41404-63:
(7*4)+(6*1)+(5*4)+(4*0)+(3*4)+(2*6)+(1*3)=81
81 % 10 = 1
So 41404-63-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H2BrF2N/c6-4-1-3(7)2-5(8)9-4/h1-2H
41404-63-1Relevant academic research and scientific papers
Regiochemically flexible substitutions of di-, tri-, and tetrahalopyridines: The trialkylsilyl trick
Schlosser, Manfred,Bobbio, Carla,Rausis, Thierry
, p. 2494 - 2502 (2007/10/03)
(Chemical Equation Presented) 2,4-Difluoropyridine, 2,4-dichloropyridine, 2,4,6-trifluoropyridine, 2,4,6-trichloropyridine and 2,3,4,6-tetrafluoropyridine react with standard nucleophiles exclusively at the 4-position under halogen displacement. However, the regioselectivity can be completely reversed if a trialkylsilyl group is introduced in the 5-position of the 2,4-dihalopyridines or in the 3-position of the 2,4,6-trihalopyridines or 2,3,4,6-tetrahalopyridine. Then only the halogen most remote from the bulky silyl unit (at the 2-position in the case of the 2,4-halopyridines, at the 6-position with the other substrates) gets involved in the exchange process. After removal of the silyl protective group the nucleophile is invariably found to occupy the nitrogen-neighboring position.
Rerouting nucleophilic substitution from the 4-position to the 2- or 6-position of 2,4-dihalopyridines and 2,4,6-trihalopyridines: The solution to a long-standing problem
Schlosser, Manfred,Rausis, Thierry,Bobbio, Carla
, p. 127 - 129 (2007/10/03)
(Chemical Equation Presented) 2,4-Difluoro-, 2,4,6-trifluoro-, and 2,3,4,6-tetrafluoropyridine undergo nucleophilic substitution preferentially if not exclusively at the 4-position. However, after the introduction of a trialkylsilyl group at C-3 or C-5, t