4505-54-8 Usage
Uses
Used in Organic Synthesis:
5-Methylcyclopentane-1,2,4-trione is used as a reagent in organic synthesis and chemical reactions due to its versatile reactivity, allowing for the creation of various organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-Methylcyclopentane-1,2,4-trione serves as an intermediate in the production of various drug compounds, contributing to the development of new medications.
Check Digit Verification of cas no
The CAS Registry Mumber 4505-54-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,5,0 and 5 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 4505-54:
(6*4)+(5*5)+(4*0)+(3*5)+(2*5)+(1*4)=78
78 % 10 = 8
So 4505-54-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H6O3/c1-3-4(7)2-5(8)6(3)9/h3H,2H2,1H3
