505-01-1 Usage
Uses
Used in Plastics Industry:
(Z)-2-Decene-4,6-diyneoic acid methyl ester is used as a monomer for the production of biodegradable plastics. Its unique structure allows for the creation of polymers with desirable properties, such as biodegradability and improved mechanical strength.
Used in Lubricants Industry:
(Z)-2-Decene-4,6-diyneoic acid methyl ester is used as a lubricant due to its ability to reduce friction and wear between moving parts. Its long hydrocarbon chain provides excellent lubricating properties, making it suitable for use in various mechanical applications.
Used in Surfactants Industry:
(Z)-2-Decene-4,6-diyneoic acid methyl ester is used as a surfactant in the formulation of detergents, cleaners, and personal care products. Its amphiphilic nature allows it to lower the surface tension of water, enhancing the solubility and dispersion of other ingredients, and improving the overall performance of the product.
Check Digit Verification of cas no
The CAS Registry Mumber 505-01-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,0 and 5 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 505-01:
(5*5)+(4*0)+(3*5)+(2*0)+(1*1)=41
41 % 10 = 1
So 505-01-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H12O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h9-10H,3-4H2,1-2H3/b10-9+
