51173-05-8 Usage
Uses
Used in Pharmaceutical Industry:
5-Fluoro-2-hydroxypyridine is utilized as an intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic benefits. 5-Fluoro-2-hydroxypyridine's fluorination and hydroxylation contribute to its reactivity and functional group compatibility, making it a valuable component in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Fluoro-2-hydroxypyridine is employed as a precursor for the production of agrochemicals, such as pesticides and herbicides. Its chemical properties enable the creation of effective compounds that can protect crops from pests and enhance agricultural productivity.
Used in Organic Synthesis:
5-Fluoro-2-hydroxypyridine also serves as a building block in organic synthesis for the production of various functionalized pyridine derivatives. Its presence in these derivatives can impart specific chemical and biological properties, broadening the scope of applications in different fields.
Overall, 5-Fluoro-2-hydroxypyridine is a multifaceted chemical compound with significant applications across different industries, primarily driven by its unique structural features and synthetic utility.
Check Digit Verification of cas no
The CAS Registry Mumber 51173-05-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,1,7 and 3 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 51173-05:
(7*5)+(6*1)+(5*1)+(4*7)+(3*3)+(2*0)+(1*5)=88
88 % 10 = 8
So 51173-05-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H4FNO/c6-4-1-2-5(8)7-3-4/h1-3H,(H,7,8)
