51617-12-0 Usage
Uses
Used in Pharmaceutical Industry:
4-AMINO-2,8-DIMETHYLQUINOLINE is used as a key intermediate in the synthesis of various pharmaceuticals due to its unique chemical structure and reactivity. Its presence in the synthesis process allows for the development of new drugs with potential therapeutic benefits.
Used in Dye Industry:
4-AMINO-2,8-DIMETHYLQUINOLINE is used as a precursor in the production of dyes, leveraging its chemical properties to create a range of colorants for various applications.
Used in Organic Chemistry Research:
As a building block in organic chemistry, 4-AMINO-2,8-DIMETHYLQUINOLINE is used in research for exploring new chemical reactions and developing novel compounds with potential applications in various fields.
Used in Antibacterial Applications:
4-AMINO-2,8-DIMETHYLQUINOLINE is investigated for its potential antibacterial properties, which could contribute to the development of new antimicrobial agents to combat resistant bacterial strains.
Used in Antimalarial Applications:
4-AMINO-2,8-DIMETHYLQUINOLINE is also being studied for its antimalarial properties, indicating its potential use in the development of new treatments for malaria.
Check Digit Verification of cas no
The CAS Registry Mumber 51617-12-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,6,1 and 7 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 51617-12:
(7*5)+(6*1)+(5*6)+(4*1)+(3*7)+(2*1)+(1*2)=100
100 % 10 = 0
So 51617-12-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2/c1-7-4-3-5-9-10(12)6-8(2)13-11(7)9/h3-6H,1-2H3,(H2,12,13)
