5434-29-7 Usage
Uses
Used in Chemical Synthesis:
3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylic acid is used as a building block or intermediate in the synthesis of various organic compounds. Its presence of two carboxylic acid groups allows for versatile chemical reactions, such as esterification, amidation, and condensation, which can lead to the formation of a wide range of derivatives with potential applications in different industries.
Used in Pharmaceutical Industry:
3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylic acid is used as a key component in the development of pharmaceutical compounds. Its unique structure and functional groups can be exploited to design and synthesize new drugs with potential therapeutic applications. 3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylic acid's reactivity and ability to form various derivatives make it a valuable asset in drug discovery and medicinal chemistry.
Used in Material Science:
3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylic acid is used as a precursor in the preparation of advanced materials, such as polymers, dyes, and pigments. 3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylic acid's chemical properties, including its aromaticity and the presence of carboxylic acid groups, can be utilized to create materials with specific properties, such as color, stability, and reactivity, which can be tailored for various applications in material science.
Used in Agricultural Industry:
3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylic acid is used as a component in the formulation of agrochemicals, such as pesticides and herbicides. Its chemical properties can be exploited to develop compounds with targeted effects on pests and weeds, while minimizing the impact on non-target organisms and the environment. 3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylic acid's potential reactivity and ability to form derivatives can contribute to the development of more effective and environmentally friendly agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 5434-29-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,3 and 4 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5434-29:
(6*5)+(5*4)+(4*3)+(3*4)+(2*2)+(1*9)=87
87 % 10 = 7
So 5434-29-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO4/c1-3-5(7(10)11)4(2)9-6(3)8(12)13/h9H,1-2H3,(H,10,11)(H,12,13)/p-2
5434-29-7Relevant academic research and scientific papers
Synthesis and pharmacological characterisation of 2,4-dicarboxy-pyrroles as selective non-competitive mGluR1 antagonists.
Micheli, Fabrizio,Fabio, Romano Di,Cavanni, Paolo,Rimland, Joseph M,Capelli, Anna Maria,Chiamulera, Cristiano,Corsi, Mauro,Corti, Corrado,Donati, Daniele,Feriani, Aldo,Ferraguti, Francesco,Maffeis, Micaela,Missio, Andrea,Ratti, Emiliangelo,Paio, Alfredo,Pachera, Roberta,Quartaroli, Mauro,Reggiani, Angelo,Sabbatini, Fabio Maria,Trist, David G,Ugolini, Annarosa,Vitulli, Giovanni
, p. 171 - 183 (2007/10/03)
Metabotropic glutamate receptors (mGluRs) are an unusual family of G-protein coupled receptor (GPCR), and are characterised by a large extracellular N-terminal domain that contains the glutamate binding site. We have identified a new class of non-competit
