5439-04-3 Usage
Uses
Used in Pharmaceutical Industry:
3,4,5-Trichloropyridine-2-carboxylic acid is used as a key intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its strong acidity and reactivity facilitate the formation of diverse chemical structures, enhancing the medicinal properties of the resulting compounds.
Used in Agrochemical Industry:
In the agrochemical sector, 3,4,5-Trichloropyridine-2-carboxylic acid is utilized as a precursor in the production of pesticides and other crop protection agents. Its chemical properties allow for the creation of effective and targeted agrochemicals, promoting agricultural productivity and crop protection.
Used in Research and Development:
3,4,5-Trichloropyridine-2-carboxylic acid is employed as a research compound in various scientific studies and experiments. Its unique properties and reactivity make it an essential tool for exploring new chemical reactions, synthesizing novel compounds, and advancing the understanding of chemical processes in various fields.
Overall, 3,4,5-Trichloropyridine-2-carboxylic acid is a crucial compound in multiple industries, including pharmaceuticals, agriculture, and research, due to its strong acidity, reactivity, and versatility in chemical synthesis. Its availability from chemical suppliers further supports its widespread use and application.
Check Digit Verification of cas no
The CAS Registry Mumber 5439-04-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,3 and 9 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 5439-04:
(6*5)+(5*4)+(4*3)+(3*9)+(2*0)+(1*4)=93
93 % 10 = 3
So 5439-04-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H2Cl3NO2/c7-2-1-10-5(6(11)12)4(9)3(2)8/h1H,(H,11,12)
5439-04-3Relevant articles and documents
Palladium-catalyzed carbonylation of polychlorinated pyridines. A simple laboratory approach to metal catalyzed carbonylation reactions
Hull Jr., John W.,Wang, Chen
, p. 411 - 417 (2007/10/03)
The palladium-catalyzed carbonylation reactions of pentachloropyridine and 2,3,4,5-tetrachloropyridine were investigated in alcoholic or aqueous solvent. The high boiling alcohol 2-ethyl-1-hexanol was an effective carbonylation solvent above 100 °C at 1 atm of CO, representing a convenient and simple method for carrying out transition metal catalyzed carbonylation reactions using standard laboratory glassware.
