5469-43-2 Usage
Uses
Used in Pharmaceutical Industry:
(E)-2-benzylbut-2-enedioic acid is used as an intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Agricultural Chemicals:
In the agricultural sector, (E)-2-benzylbut-2-enedioic acid serves as a key component in the production of agricultural chemicals, contributing to the development of more effective and environmentally friendly products.
Used in Pigment Industry:
(E)-2-benzylbut-2-enedioic acid is utilized as a raw material in the manufacturing of pigments, where its properties contribute to the creation of vibrant and stable colorants for various applications.
Used as a Cross-Linking Agent in Polymer and Resin Synthesis:
(E)-2-benzylbut-2-enedioic acid is employed as a cross-linking agent in the synthesis of polymers and resins, enhancing their structural integrity and performance characteristics.
Used in Organic Synthesis and Chemical Research:
Due to its unique molecular structure and properties, (E)-2-benzylbut-2-enedioic acid has potential applications in the field of organic synthesis and chemical research, where it can be used to develop new compounds and materials with novel properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 5469-43-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 9 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 5469-43:
(6*5)+(5*4)+(4*6)+(3*9)+(2*4)+(1*3)=112
112 % 10 = 2
So 5469-43-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H10O4/c12-10(13)7-9(11(14)15)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H,12,13)(H,14,15)/b9-7+
