58107-62-3 Usage
Uses
Used in Scientific Research:
H-PRO-NHET HCL is used as a chemical compound in scientific research for the synthesis of more complex molecules. Its role in the creation of these molecules is crucial, as it provides a foundation for further chemical reactions and the development of new compounds.
Used in Pharmaceutical Industry:
H-PRO-NHET HCL is used as a building block in the pharmaceutical industry for the development of new drugs and therapeutic agents. Its properties as an amino acid derivative make it a valuable component in the synthesis of various pharmaceutical compounds, potentially leading to the discovery of novel treatments and medications.
Used in Chemical Synthesis:
In the field of chemical synthesis, H-PRO-NHET HCL is used as a reagent or intermediate in the production of other chemical compounds. Its versatility in reacting with other molecules allows for the creation of a wide range of products, from specialty chemicals to advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 58107-62-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,1,0 and 7 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 58107-62:
(7*5)+(6*8)+(5*1)+(4*0)+(3*7)+(2*6)+(1*2)=123
123 % 10 = 3
So 58107-62-3 is a valid CAS Registry Number.
InChI:1S/C7H14N2O.ClH/c1-2-8-7(10)6-4-3-5-9-6;/h6,9H,2-5H2,1H3,(H,8,10);1H
