60565-88-0 Usage
Uses
Used in Chemical Synthesis:
Bis(4-methylphenyl)iodonium hexafluorophosphate is used as a reagent in chemical synthesis for its ability to facilitate specific reactions and improve the yield of desired products. Its unique structure allows it to participate in various chemical transformations, making it a valuable tool in the synthesis of complex organic molecules.
Used in Photochemistry:
In the field of photochemistry, Bis(4-methylphenyl)iodonium hexafluorophosphate is used as a photosensitizer for its strong UV absorption peak at 267nm. This property enables it to absorb light and initiate photochemical reactions, which can be useful in the synthesis of various compounds and materials.
Used in Electrochemistry:
Bis(4-methylphenyl)iodonium hexafluorophosphate is used as an electrolyte in electrochemical applications due to its ability to conduct ions and facilitate charge transfer. Its use in this field can enhance the performance of electrochemical devices, such as batteries and fuel cells.
Used in Analytical Chemistry:
As an analytical reagent, Bis(4-methylphenyl)iodonium hexafluorophosphate is used for the detection and quantification of specific substances in various samples. Its unique UV absorption properties make it a useful tool for spectroscopic analysis and other analytical techniques.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Bis(4-methylphenyl)iodonium hexafluorophosphate is used as an intermediate in the synthesis of various drugs and drug candidates. Its unique chemical properties allow it to be a key component in the development of new medications with potential therapeutic applications.
Used in Material Science:
In material science, Bis(4-methylphenyl)iodonium hexafluorophosphate is used in the development of novel materials with specific properties. Its unique structure and reactivity can contribute to the creation of advanced materials with applications in various industries, such as electronics, aerospace, and energy.
Check Digit Verification of cas no
The CAS Registry Mumber 60565-88-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,5,6 and 5 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 60565-88:
(7*6)+(6*0)+(5*5)+(4*6)+(3*5)+(2*8)+(1*8)=130
130 % 10 = 0
So 60565-88-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H14I.F6P/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;1-7(2,3,4,5)6/h3-10H,1-2H3;/q+1;-1
60565-88-0Relevant academic research and scientific papers
Cu-catalyzed arylcarbocyclization of alkynes with diaryliodonium salts through C-c bond formation on inert C(sp3)-H bond
Peng, Jing,Chen, Chao,Chen, Junjie,Su, Xiang,Xi, Chanjuan,Chen, Hui
supporting information, p. 3776 - 3779 (2014/08/05)
Copper-catalyzed arylcarbocyclization reaction of alkynes was realized with diaryliodonium salts through C-C bond formation on an inert C(sp3)-H bond. This method provides an efficient cyclization of alkyl alkynes to generate carbocycles with good step-economy. Theoretical study revealed an interesting Cu-catalyzed concerted pathway of the C-C bond formation.