6142-57-0 Usage
Uses
Used in Pharmaceutical Industry:
cis-2-methylcyclopropanecarboxylic acid is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows for the creation of complex molecules that can have potential therapeutic applications.
Used in Chemical Industry:
cis-2-methylcyclopropanecarboxylic acid is used as a building block in the synthesis of other complex organic molecules. Its cyclopropane ring and carboxylic acid group provide a versatile platform for further chemical reactions, enabling the development of new chemical products.
Used in Research and Development:
cis-2-methylcyclopropanecarboxylic acid is used as a research compound to study its properties and potential applications in various fields. Its unique structure and reactivity can provide insights into new chemical reactions and pathways, contributing to the advancement of scientific knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 6142-57-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,1,4 and 2 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6142-57:
(6*6)+(5*1)+(4*4)+(3*2)+(2*5)+(1*7)=80
80 % 10 = 0
So 6142-57-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H8O2/c1-3-2-4(3)5(6)7/h3-4H,2H2,1H3,(H,6,7)
6142-57-0Relevant academic research and scientific papers
SUBSTITUTED CARBOXAMIDES
-
Page/Page column 16-17, (2008/12/08)
This application relates to a substituted carboxamide compound of formula I, or a pharmaceutically acceptable salt thereof, as defined herein, a pharmaceutical composition thereof, and its use in treating pain.
