6188-02-9 Usage
Type of compound
Derivative of benzoic acid
Structural components
Contains a pyridine ring and an amino group attached to a benzene ring
Usage
Building block for the synthesis of pharmaceutical drugs in the pharmaceutical industry
Biological activities
Studied for its potential biological activities
Applications
Potential applications in medicinal chemistry and drug discovery due to its unique structure and functional groups.
Check Digit Verification of cas no
The CAS Registry Mumber 6188-02-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,1,8 and 8 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6188-02:
(6*6)+(5*1)+(4*8)+(3*8)+(2*0)+(1*2)=99
99 % 10 = 9
So 6188-02-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H10N2O3/c16-12(9-4-3-7-14-8-9)15-11-6-2-1-5-10(11)13(17)18/h1-8H,(H,15,16)(H,17,18)
