6307-91-1 Usage
Uses
Used in Organic Synthesis:
2,6-dibromo-3,4,5-trimethoxy-benzoic acid is used as a key intermediate in organic synthesis for the production of various bioactive compounds. Its unique molecular structure allows for the creation of a wide range of pharmaceuticals and agrochemicals, making it an essential component in the development of new and effective chemical entities.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2,6-dibromo-3,4,5-trimethoxy-benzoic acid is utilized as a starting material for the development of new drugs. Its potential medicinal properties, including antioxidant and antitumor activities, make it a promising candidate for the treatment of various diseases and conditions. Researchers are actively exploring its therapeutic potential to discover novel drug candidates with improved efficacy and safety profiles.
Used in Medicinal Chemistry:
2,6-dibromo-3,4,5-trimethoxy-benzoic acid plays a crucial role in medicinal chemistry, where it is employed for the design and synthesis of new chemical entities with potential therapeutic applications. Its unique molecular features enable the development of innovative drug candidates that can target specific biological pathways and mechanisms, offering new treatment options for various diseases.
Used in Drug Development:
In the field of drug development, 2,6-dibromo-3,4,5-trimethoxy-benzoic acid is used as a precursor in the synthesis of bioactive compounds with potential therapeutic benefits. Its versatile molecular structure allows for the creation of diverse drug candidates that can be optimized for improved pharmacokinetic and pharmacodynamic properties, leading to the development of more effective and safer medications.
Check Digit Verification of cas no
The CAS Registry Mumber 6307-91-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 7 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6307-91:
(6*6)+(5*3)+(4*0)+(3*7)+(2*9)+(1*1)=91
91 % 10 = 1
So 6307-91-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H10Br2O5/c1-15-7-5(11)4(10(13)14)6(12)8(16-2)9(7)17-3/h1-3H3,(H,13,14)
