6636-94-8 Usage
Uses
Used in Medicinal Chemistry:
1-Phenylamino-cyclopentanecarboxylic acid is used as a building block for the synthesis of various pharmaceutical compounds due to its unique cyclic structure and functional groups.
Used in Drug Development:
1-Phenylamino-cyclopentanecarboxylic acid is used as a potential candidate for the development of new drugs, as its specific structure may contribute to novel therapeutic agents. Further research and investigation are required to fully understand its properties and potential applications in this field.
Check Digit Verification of cas no
The CAS Registry Mumber 6636-94-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,3 and 6 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6636-94:
(6*6)+(5*6)+(4*3)+(3*6)+(2*9)+(1*4)=118
118 % 10 = 8
So 6636-94-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO2/c14-11(15)12(8-4-5-9-12)13-10-6-2-1-3-7-10/h1-3,6-7,13H,4-5,8-9H2,(H,14,15)
