68500-35-6 Usage
Uses
Used in Pharmaceutical Industry:
4-HYDRAZINO-8-METHYLQUINOLINE is used as a pharmaceutical intermediate for the synthesis of new drugs. Its unique chemical structure allows for the development of compounds with potential therapeutic effects, making it a valuable asset in drug discovery and medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical industry, 4-HYDRAZINO-8-METHYLQUINOLINE is used as a precursor for the synthesis of agricultural pesticides. Its chemical properties enable the creation of effective and targeted pest control agents, contributing to improved crop protection and yield.
Used in Materials Science:
4-HYDRAZINO-8-METHYLQUINOLINE is utilized in materials science for the development of functional materials. Its unique structure and properties can be harnessed to create materials with specific characteristics, such as conductivity, magnetism, or catalytic activity, for use in various applications, including sensors, catalysts, and energy storage devices.
Further research and development of 4-HYDRAZINO-8-METHYLQUINOLINE may lead to innovative and valuable applications across different industries, expanding its potential impact and utility.
Check Digit Verification of cas no
The CAS Registry Mumber 68500-35-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,5,0 and 0 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 68500-35:
(7*6)+(6*8)+(5*5)+(4*0)+(3*0)+(2*3)+(1*5)=126
126 % 10 = 6
So 68500-35-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3/c1-7-3-2-4-8-9(13-11)5-6-12-10(7)8/h2-6H,11H2,1H3,(H,12,13)
68500-35-6Relevant academic research and scientific papers
Synthesis and in vitro evaluation of new benzenesulfonamides as antileishmanial agents
Borges, Julio C.,Carvalho, Adriana V.,Bernardino, Alice M.R.,Oliveira, Ce?sar D.,Pinheiro, Luiz C.S.,Marra, Roberta K.F.,Castro, Helena C.,Wardell, Solange M.S.V.,Wardell, James L.,Amaral, Veronica F.,Canto-Cavalheiro, Marilene M.,Leon, Leonor L.,Genestra, Marcelo
, p. 980 - 986 (2014/06/24)
This paper describes the synthesis and the antileishmanial activity of new pyrazolyl benzenesulfonamide derivatives. These were elucidated by spectrometric methods. Some compounds showed a significant in vitro activity against Leishmania amazonensis, highlighting the derivative 1e. These pyrazolyl benzenesulfonamide derivatives did not show any toxicity in murine macrophage.