6902-91-6 Usage
Description
(3Z,7Z)-3,7-Dimethyl-10-propan-2-ylidene-cyclodeca-3,7-dien-1-one is a complex organic compound characterized by its unique molecular structure, which features a cyclodeca-3,7-dien-1-one core with two double bonds at positions 3 and 7, as well as two methyl groups at the same positions. Additionally, it has a propan-2-ylidene group attached to the 10th carbon. (3Z,7Z)-3,7-Dimethyl-10-propan-2-ylidene-cyclodeca-3,7-dien-1-one is likely to have specific chemical properties and potential applications in various fields due to its structural features.
Uses
1. Used in Pharmaceutical Industry:
(3Z,7Z)-3,7-Dimethyl-10-propan-2-ylidene-cyclodeca-3,7-dien-1-one can be used as an active pharmaceutical ingredient (API) for the development of new drugs targeting various diseases. Its unique structure may allow it to interact with specific biological targets, potentially leading to novel therapeutic effects.
2. Used in Chemical Research:
(3Z,7Z)-3,7-Dimethyl-10-propan-2-ylidene-cyclodeca-3,7-dien-1-one can serve as a starting material or intermediate in the synthesis of other complex organic molecules. Researchers in the field of organic chemistry may utilize it to explore new reaction pathways, develop innovative synthetic methods, or create new compounds with specific properties.
3. Used in Material Science:
The unique structure of (3Z,7Z)-3,7-Dimethyl-10-propan-2-ylidene-cyclodeca-3,7-dien-1-one may endow it with special physical or chemical properties that could be harnessed in the development of new materials. For example, it could be used in the creation of advanced polymers, coatings, or other materials with specific characteristics.
4. Used in Agrochemical Industry:
(3Z,7Z)-3,7-Dimethyl-10-propan-2-ylidene-cyclodeca-3,7-dien-1-one may also have potential applications in the agrochemical industry, possibly as a component in the development of new pesticides, herbicides, or other agricultural chemicals. Its specific mode of action and target pests or weeds would need to be determined through further research and development.
5. Used in Fragrance Industry:
Given the complex structure of (3Z,7Z)-3,7-Dimethyl-10-propan-2-ylidene-cyclodeca-3,7-dien-1-one, it may possess unique olfactory properties that could be of interest to the fragrance industry. It could potentially be used as a component in the creation of new perfumes, colognes, or other scented products.
Synthesis Reference(s)
Tetrahedron Letters, 24, p. 3489, 1983 DOI: 10.1016/S0040-4039(00)86020-7
Safety Profile
A poison by ingestion.
When heated to decomposition it emits
acrid smoke and irritating vapors.
Check Digit Verification of cas no
The CAS Registry Mumber 6902-91-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,0 and 2 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6902-91:
(6*6)+(5*9)+(4*0)+(3*2)+(2*9)+(1*1)=106
106 % 10 = 6
So 6902-91-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H22O/c1-11(2)14-9-8-12(3)6-5-7-13(4)10-15(14)16/h7-8H,5-6,9-10H2,1-4H3/b12-8+,13-7+
6902-91-6Relevant articles and documents
A FIRST TOTAL SYNTHESIS OF GERMACRONE BY INTRAMOLECULAR ALKYLATION OF PRETECTED CYANOHYDRIN
Takahashi, Takashi,Kitamura, Kyoko,Nemoto, Hisao,Tsuji, Jiro,Miura, Iwao
, p. 3489 - 3492 (1983)
A total synthesis of Germacrone by the intramolecular alkylation of a carbanion generated from protected cyanohydrin is presented.