77628-52-5 Usage
Uses
Used in Pharmaceutical Industry:
6-Phenylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid is used as a precursor in the synthesis of various pharmaceutical compounds for its potential anti-inflammatory, anti-cancer, and antimicrobial properties. Its unique structure allows for the development of new drugs that can target specific biological pathways and diseases.
Used in Chemical Research:
In the field of chemical research, 6-Phenylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid serves as a valuable compound for studying the structure-activity relationships of related molecules. It aids in understanding the effects of structural modifications on the biological activity and pharmacokinetic properties of the synthesized compounds.
Used in Drug Development:
6-Phenylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid is used as a lead compound in drug development for its potential therapeutic applications. Researchers are investigating its efficacy in treating various diseases, including inflammation, cancer, and microbial infections, by modulating specific biological targets and pathways.
Used in Medicinal Chemistry:
In medicinal chemistry, 6-Phenylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid is employed as a key building block for the design and synthesis of novel therapeutic agents. Its unique chemical properties and structural features make it an attractive candidate for the development of new drugs with improved potency, selectivity, and pharmacokinetic profiles.
Used in Antimicrobial Applications:
6-Phenylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid is used as an antimicrobial agent for its potential to inhibit the growth of various microorganisms, including bacteria and fungi. Its ability to target specific cellular processes and enzymes makes it a promising candidate for the development of new antimicrobial drugs to combat drug-resistant infections.
Used in Anti-inflammatory Applications:
6-Phenylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid is used as an anti-inflammatory agent for its potential to modulate inflammatory pathways and reduce inflammation in various diseases, such as arthritis, asthma, and inflammatory bowel disease. Its pharmacological properties make it a valuable compound for the development of new anti-inflammatory drugs with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 77628-52-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,6,2 and 8 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 77628-52:
(7*7)+(6*7)+(5*6)+(4*2)+(3*8)+(2*5)+(1*2)=165
165 % 10 = 5
So 77628-52-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H8N2O2S/c15-11(16)10-9(8-4-2-1-3-5-8)13-12-14(10)6-7-17-12/h1-7H,(H,15,16)
77628-52-5Relevant academic research and scientific papers
IMIDAZOLO DERIVATIVES, COMPOSITIONS AND METHODS AS OREXIN ANTAGONISTS
-
, (2020/12/29)
This disclosure is directed to substituted Imidazolo[2,1-b]oxazole, lmidazolo[2,1-b]thiazole, Imidazolo[2,1-b]oxadiazole, lmidazolo[2,1-b]oxadiathiazole derivatives of compounds that are antagonists of orexin receptors, and which are useful in the treatme
