84-32-2 Usage
Uses
Used in Textile and Paper Industries:
2-Chloroanthraquinone-3-carboxylic acid is utilized as a dye intermediate for the production of various dyes, specifically in the textile and paper industries. Its chemical properties allow for the creation of vibrant and stable dyes that are essential for coloring fabrics and paper products.
Used in Organic Synthesis:
As a reagent in organic synthesis reactions, 2-Chloroanthraquinone-3-carboxylic acid plays a crucial role in the synthesis of complex organic compounds. Its unique structure facilitates specific chemical transformations, making it a valuable component in the development of new chemical entities.
Used in Medicinal Chemistry:
2-Chloroanthraquinone-3-carboxylic acid has been studied for its potential applications in medicinal chemistry. Its chemical properties and structural features make it a promising candidate for the development of new pharmaceuticals, particularly in the area of anticancer research.
Used as an Anticancer Agent:
In the field of oncology, 2-Chloroanthraquinone-3-carboxylic acid has shown potential as an anticancer agent. Its ability to interact with biological targets and modulate cellular processes suggests that it could be a valuable component in the development of new cancer therapies.
Used in Antimicrobial Applications:
2-Chloroanthraquinone-3-carboxylic acid has been found to exhibit antimicrobial properties, making it useful in applications where the control of microbial growth is necessary. This could include uses in healthcare settings, food preservation, and other industries where preventing microbial contamination is critical.
Used in Antioxidant Applications:
The antioxidant properties of 2-Chloroanthraquinone-3-carboxylic acid make it a versatile compound in various industrial and scientific applications. Its ability to neutralize reactive oxygen species and protect against oxidative damage can be harnessed in the development of products that require preservation or protection from oxidation.
Check Digit Verification of cas no
The CAS Registry Mumber 84-32-2 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 8 and 4 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 84-32:
(4*8)+(3*4)+(2*3)+(1*2)=52
52 % 10 = 2
So 84-32-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H7ClO4/c16-12-6-10-9(5-11(12)15(19)20)13(17)7-3-1-2-4-8(7)14(10)18/h1-6H,(H,19,20)
