15254-27-0 Usage
Uses
Used in Pharmaceutical Synthesis:
2-(3-chloro-4-toluoyl)benzoic acid is utilized as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs with enhanced therapeutic properties. Its unique structure allows for the creation of molecules with specific biological activities, which can be tailored for targeted treatments.
Used in Agrochemical Production:
In the agrochemical industry, 2-(3-chloro-4-toluoyl)benzoic acid serves as a crucial component in the formulation of various agrochemicals. It is used to develop compounds that can protect crops from pests and diseases, thereby increasing agricultural productivity and ensuring food security.
Used in Organic Synthesis:
2-(3-chloro-4-toluoyl)benzoic acid is employed as a versatile building block in organic synthesis. Its reactivity and structural features make it suitable for the creation of a wide range of organic compounds, including those with potential applications in materials science, dyes, and other specialty chemicals.
While the specific industrial applications of 2-(3-chloro-4-toluoyl)benzoic acid may vary, its physical and chemical properties suggest a broad spectrum of uses across different sectors. Its potential value lies in its adaptability and the ability to be integrated into various chemical processes and products.
Check Digit Verification of cas no
The CAS Registry Mumber 15254-27-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,2,5 and 4 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 15254-27:
(7*1)+(6*5)+(5*2)+(4*5)+(3*4)+(2*2)+(1*7)=90
90 % 10 = 0
So 15254-27-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H11ClO3/c1-9-6-7-10(8-13(9)16)14(17)11-4-2-3-5-12(11)15(18)19/h2-8H,1H3,(H,18,19)
