85763-07-1 Usage
Chemical structure
A complex compound with a glycerol backbone, two palmitoyl groups, a benzenebutanoyl group, and two bis(2-chloroethyl)amino groups.
Composition
Lipid derivative, composed of fatty acid chains (palmitoyl groups) and a benzenebutanoyl group.
Functional groups
Contains bis(2-chloroethyl)amino groups, which may contribute to reactivity or biological activity.
Potential applications
Research or pharmaceutical applications, due to its complex structure and potential biological relevance.
Biological relevance
May have properties related to lipid metabolism or cellular structure, given its lipid derivative nature.
It's important to note that this is a complex and potentially biologically relevant compound, and further research would be needed to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 85763-07-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,7,6 and 3 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 85763-07:
(7*8)+(6*5)+(5*7)+(4*6)+(3*3)+(2*0)+(1*7)=161
161 % 10 = 1
So 85763-07-1 is a valid CAS Registry Number.
InChI:InChI=1/C49H85Cl2NO6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-31-47(53)56-42-46(43-57-48(54)32-28-26-24-22-20-18-16-14-12-10-8-6-4-2)58-49(55)33-29-30-44-34-36-45(37-35-44)52(40-38-50)41-39-51/h34-37,46H,3-33,38-43H2,1-2H3
85763-07-1Relevant articles and documents
1,3-Dipalmitoylglycerol ester of chlorambucil as a lymphotropic, orally administrable antineoplastic agent
Garzon-Aburbeh,Poupaert,Claesen,Dumont,Atassi
, p. 1200 - 1203 (2007/10/02)
A glyceridere derivative of chlorambucil (2), 1,3-dipalmitoyl-2-[4-[bis(2-chloroethyl)amino]benzenebutanoyl]glycerol (1), was synthesized and tested as an orally administrable antineoplastic drug endowed with lymphotropic properties. A significantly highe