872355-55-0 Usage
Uses
Used in Pharmaceutical Industry:
1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 6-methylis used as a precursor in the synthesis of new drugs for the treatment of various diseases and conditions. Its unique structure allows for the development of molecules with specific biological activities, making it a valuable component in drug discovery and design processes.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 6-methylis used as a starting material for the creation of novel compounds with potential therapeutic effects. Its pyrrolopyridine ring system provides a versatile scaffold for the attachment of various functional groups, facilitating the exploration of new chemical space and the discovery of innovative drug candidates.
Used in Drug Development:
1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 6-methylis employed in drug development as a component of biologically active molecules. Its incorporation into drug candidates can contribute to the modulation of specific biological targets, potentially leading to the development of new treatments for a range of medical conditions.
Used in Biological Target Modulation:
1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 6-methylhas been studied for its potential therapeutic effects on specific biological targets. By interacting with these targets, 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 6-methylmay contribute to the regulation of biological processes, offering a pathway to new therapeutic interventions for various diseases and disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 872355-55-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,2,3,5 and 5 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 872355-55:
(8*8)+(7*7)+(6*2)+(5*3)+(4*5)+(3*5)+(2*5)+(1*5)=190
190 % 10 = 0
So 872355-55-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O2/c1-5-7(9(12)13)4-6-2-3-10-8(6)11-5/h2-4H,1H3,(H,10,11)(H,12,13)
872355-55-0Relevant academic research and scientific papers
AZAINDOLE DERIVATIVES AS INHIBITORS OF P38 KINASE
-
Page/Page column 76, (2010/11/24)
The invention is directed to methods to inhibit p38 kinase, preferably p38-α using compounds which are azaindoles wherein the azaindoles are coupled through an azacyclic linker to another cyclic moiety.
