946053-90-3 Usage
General Description
(S)-4-Fluoro-indan-1-ylamine is a chemical compound with the molecular formula C9H10FNO. It is a chiral amine with a fluorine atom attached to the 4th position of an indane ring. (S)-4-FLUORO-INDAN-1-YLAMINE is commonly used in the pharmaceutical industry as a building block for the synthesis of various drug molecules and pharmaceutical intermediates. It is also known for its potential application in medicinal chemistry and drug discovery due to its unique structural properties and biological activity. Additionally, (S)-4-Fluoro-indan-1-ylamine is used as a reference compound in analytical chemistry and as a research tool in chemical and biological studies. Overall, this chemical compound has significant importance in various fields, particularly in the development of new pharmaceuticals and the understanding of chemical and biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 946053-90-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,6,0,5 and 3 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 946053-90:
(8*9)+(7*4)+(6*6)+(5*0)+(4*5)+(3*3)+(2*9)+(1*0)=183
183 % 10 = 3
So 946053-90-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H10FN/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3,9H,4-5,11H2/t9-/m0/s1
946053-90-3Relevant articles and documents
NOVEL COMPOUNDS
-
Page/Page column 56, (2022/03/22)
The invention relates to compounds of formula (I) and related aspects.
SUBSTITUTED FLUOROETHYL UREAS AS ALPHA 2 ADRENERGIC AGENTS
-
Page/Page column 19, (2008/12/04)
Therapeutic compounds, and methods, compositions, and medicaments related thereto are disclosed herein.
Monofluorinated derivatives of N-propargyl-1-aminoindan and their use as inhibitors of monoamine oxidase
-
, (2008/06/13)
N-propargyl-1-amonoindan monofluorinated in the phenyl ring and their use as selective inhibitors of monoamine oxidase (MAO). There are provided several processes for the preparation of these novel compounds. There are also provided as novel compounds