96530-81-3 Usage
Uses
Used in Pharmaceutical Industry:
4-Fluoro-2-methoxypyridine is used as a key building block for the synthesis of various pharmaceuticals, contributing to the development of new drugs with improved therapeutic properties. Its unique structure and reactivity enable the creation of diverse molecular entities with potential medicinal applications.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Fluoro-2-methoxypyridine serves as an intermediate in the production of various agrochemicals, including pesticides and herbicides. Its incorporation into these compounds can enhance their effectiveness in controlling pests and weeds, thereby improving crop yields and quality.
Used in Specialty Chemicals Industry:
4-Fluoro-2-methoxypyridine is utilized as a versatile intermediate in the synthesis of specialty chemicals, such as dyes, fragrances, and other fine chemicals. Its unique chemical properties allow for the development of novel compounds with specific characteristics, catering to various industrial needs.
Used in Research and Development:
4-Fluoro-2-methoxypyridine is employed in research and development laboratories for exploring its unique properties and potential applications. Its participation in various chemical transformations makes it an invaluable tool for synthetic chemists in the development of new molecules for a wide range of applications, including materials science, catalysis, and more.
Check Digit Verification of cas no
The CAS Registry Mumber 96530-81-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,6,5,3 and 0 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 96530-81:
(7*9)+(6*6)+(5*5)+(4*3)+(3*0)+(2*8)+(1*1)=153
153 % 10 = 3
So 96530-81-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H6FNO/c1-9-6-4-5(7)2-3-8-6/h2-4H,1H3
96530-81-3Relevant academic research and scientific papers
Lactam enolate-pyridone addition: Synthesis of 4-halocytisines
Durkin, Patrick,Magrone, Pietro,Matthews, Stella,Dallanoce, Clelia,Gallagher, Timothy
scheme or table, p. 2789 - 2791 (2010/12/25)
The application of a lactam enolate-pyridone addition sequence, originally developed for cytisine, has been applied successfully to generate the first examples of 4-halocytisines. Variation of the lactam component provides cyfusine and 4-fluorocyfusine.
