97135-12-1 Usage
Uses
Used in Chemical Synthesis:
8,9,10,11, Tetrahydrodibenz(a,h)acridine is used as a key intermediate in the synthesis of epoxy-diol derivatives of dibenz(a,h)acridine (Catalogue number D41690). This application is crucial for the development of compounds that may have potential applications in various fields, despite the carcinogenic nature of the end product.
Used in Research and Development:
In the scientific community, 8,9,10,11, Tetrahydrodibenz(a,h)acridine is utilized for research purposes, particularly in understanding the mechanisms of carcinogenesis and the development of potential countermeasures or treatments. Its role as an intermediate allows researchers to explore the properties and reactions of related compounds, contributing to the broader knowledge of chemical carcinogens and their impact on health.
Check Digit Verification of cas no
The CAS Registry Mumber 97135-12-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,7,1,3 and 5 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 97135-12:
(7*9)+(6*7)+(5*1)+(4*3)+(3*5)+(2*1)+(1*2)=141
141 % 10 = 1
So 97135-12-1 is a valid CAS Registry Number.
InChI:InChI=1/C21H17N/c1-3-7-17-14(5-1)11-12-20-19(17)13-16-10-9-15-6-2-4-8-18(15)21(16)22-20/h1,3,5,7,9-13H,2,4,6,8H2
