The d-Lysergic acid diethylamide bitartrate, with the CAS registry number 15232-63-0, is also known as Ergoline-8-carboxamide,9,10-didehydro-N,N-diethyl-6-methyl-, (8β)-,(2R,3R)-2,3-dihydroxybutanedioate. This chemical's molecular formula is C₂₄H₃₁N₃O₇ and molecular weight is 473.5188. What's more, its systematic name is called (8β)-N,N-Diethyl-6-methyl-9,10-didehydroergoline-8-carboxamide 2,3-dihydroxybutanedioate (1:1).

Physical properties about d-Lysergic acid diethylamide bitartrate are: (1)ACD/LogP: 2.74; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 28.48 Å²; (7)Flash Point: 281.2 °C; (8)Enthalpy of Vaporization: 81.91 kJ/mol; (9)Boiling Point: 541.3 °C at 760 mmHg; (10)Vapour Pressure: 8.82E-12 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C(O)[C@H](O)[C@@H](O)C(=O)O.O=C(N(CC)CC)[C@@H]3/C=C2/c4cccc1c4c(cn1)C[C@H]2N(C3)C
(2) InChI: InChI=1/C20H25N3O.C4H6O6/c1-4-23(5-2)20(24)14-9-16-15-7-6-8-17-19(15)13(11-21-17)10-18(16)22(3)12-14;5-1(3(7)8)2(6)4(9)10/h6-9,11,14,18,21H,4-5,10,12H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/t14-,18-;1-,2-/m11/s1
(3) InChIKey: HQMPRARIZOUKRO-AJLBZGGQBG