- CAS Number
- Product Names
- Molecular Formula
| 112375-43-6 | methyl (7Z)-9-methyldec-7-enoate | C12H22 O2 |
| 523-39-7 | Menlaquinone 9 | C56H80O2 |
| 42794-63-8 | MK 142 | C22H32N2O6•2CH4O3S |
| 94232-81-2 | methyl 12,15-dihydroxypentadecanoate | C16H32 O4 |
| 173558-65-1 | MF 13 (pharmaceutical) |
| 18968-99-5 | MAGNESIUM PEMOLINE | C9H10MgN2O4 |
| 26638-03-9 | METHOXYPHENOL | C7H8 O2 |
| 4164-32-3 | Morpholine, 4-nitro- (6CI, 7CI, 8CI, 9CI) | C4H8N2O3 |
| 71412-09-4 | morpholinepropylamine | C7H16 N2 O |
| 38193-77-0 | menfegol | (C2H4 O)n C16 H24 O |
| 1128-67-2 | MBTH INDICATOR | C8H9 N3 S |
| 75217-25-3 | methyl 1H-benzimidazol-2-ylcarbamate - N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide (1:1) | C24H25Cl3N6O4 |
| 83512-98-5 | Manganese black |
| 2490-22-4 | methyl 2-methyloctadecanoate | C20H40 O2 |
| 86381-89-7 | Methylsulfenyliodide | CH3IS |
| 14097-18-8 | Metaphosphimic acid(H6P3O6N3) | H6N3 O6 P3 |
| 272-90-2 | Mercury, m-oxo-m-1,2-phenylenedi- (9CI) | C6H4 Hg2 O |
| 7452-51-9 | Mordant Violet 1 | C27H27NO6 |
| 80050-17-5 | Mold-X | C18H24O8 |
| 7625-53-8 | methyl DL-alaninate | C4H9NO2 |
| 104973-52-6 | methyl (E,4R)-4-[(2R)-2-acetamido-3-phenyl-propanoyl]oxy-4-[(2R)-2-met hyloxiran-2-yl]but-2-enoate | C19H23NO6 |
| 14090-83-6 | METHYL (PHENYLSULFINYL)ACETATE | C9H10O3S |
| 6829-52-3 | methylidynephosphane | CHP |
| 1217-49-8 | methyl phenanthrene-9-carboxylate | C16H12O2 |
| 146458-08-4 | Methanesulfonamide,N-[2-[3-bromo-5-[(2-ethyl-4,5-dimethyl-6-oxo-1(6H)-pyrimidinyl)methyl]-2-benzofuranyl]phenyl]-1,1,1-trifluoro- | C24H21 Br F3 N3 O4 S |
| 134910-54-6 | Morfast Brown 100 |
| 21412-42-0 | methyl (1aS,1bR,2R,3R,4R,5R,5aR,6aR)-3,5a-dihydroxy-1b-methyl-7-oxo-4-(prop-1-en-2-yl)octahydro-1aH-2,5-(epoxymethano)indeno[1,2-b]oxirene-1a-carboxylate | C16H20O7 |
| 37526-80-0 | melarsonic acid | C13H11AsK2N6O4S2 |
| 14926-08-0 | MAGNESIUM-P-AMINOBENZOATE | C7H7 N O2 . 1/2 Mg |
| 64732-07-6 | methyl (carbamoylamino)(hydroxy)acetate | C4H8 N2 O4 |
| 681-06-1 | Methylthiophosphonic acid O,O-dimethyl ester | C3H9O2PS |
| 147096-97-7 | MSB2 protein |
| 165040-77-7 | MAT-R protein |
| 6447-89-8 | methyl (4-methyl-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)acetate | C20H26 N2 O S |
| 75535-37-4 | MAGNESIUM FLUOROGERMANATE | F2Ge2H2MgO4 |
| 18374-18-0 | methyl (41R,12S,13aS)-13a-ethyl-12-hydroxy-2,3,41,5,6,12,13,13a-octahydro-1H-indolo[3,2,1-de]pyrido[3,2,1-ij][1,5]naphthyridine-12-carboxylate | C21H26N2O3 |
| 118201-39-1 | methyl 4-{2-[(difluoromethyl)sulfanyl]phenyl}-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate | C14H14 F2 N2 O3 S |
| 100286-91-7 | MO 113 | C13H7 N3 O5 S . Na |
| 12044-65-4 | MAUCHERITE | As8Ni11 |
| 51772-30-6 | M-METHYLPROPIOPHENONE | C10H12O |
| 111-79-5 | Methyl trans-2-nonenoate | C10H18O2 |
| 109493-34-7 | Morpholine, 4-((1,2,3,4-tetrahydro-3,7-dimethyl-4-oxo-1-(phenylmethyl) -2-thioxopyrido(2,3-d)pyrimidin-6-yl)carbonyl)- | C21H22 N4 O3 S |
| 36478-56-5 | Mammea C/OB | C19H24O5 |
| 12540-69-1 | Manganese,bis(hydrazinecarbodithioato-N2,S)- (9CI) | C2H6 Mn N4 S4 |
| 7782-66-3 | Mercury(II) phosphate. | Hg3O8P2 |
| 16475-90-4 | METHYL 5-ACETYLSALICYLATE | C10H10O4 |
| 51446-77-6 | methyl (3beta,5alpha,7beta)-3,7-dihydroxycholan-24-oate | C25H42O4 |
| 52019-35-9 | Methyloxirane polymer with oxirane, ether with 2,6-bis[(bis(2-hydroxyethyl)amino) methyl]-4-nonylphenol (5:1) | C25H46N2O5.5(C3H6O.C2H4O)x |
| 162330-32-7 | methyl O-galactopyranosyl-1-3-O-(fucopyranosyl-1-4)-2-acetamido-2-deoxy-6-O-sulfoglucopyranoside | C21H37 N O18 S . Na |
| 79893-19-9 | methyl 5-(acetylamino)-o-anisate | C11H13 N O4 |
| 2223-96-3 | Methyl 4-chloro-2-Methylthio-5-pyriMidinecarboxylate | C9H11 Cl N2 O2 S |
| 119264-65-2 | Methanone,(2,4-dihydroxyphenyl)[(2R,3R,4R,5R)-5-(2,4-dihydroxyphenyl)tetrahydro-2-(4-hydroxyphenyl)-4-[(4-hydroxyphenyl)methyl]-3-furanyl]-,rel-(-)- | C30H26 O8 |
| 84712-70-9 | methyl (Z,Z,Z)-8-dodecyl-8-[(4-methoxy-1,4-dioxobut-2-enyl)oxy]-3,6,10-trioxo-2,7,9-trioxa-8-stannatrideca-4,11-dien-13-oate | C27H40 O12 Sn |
| 83918-75-6 | methyl 3alpha-[(ethoxycarbonyl)oxy]-12-oxo-5-beta-cholan-24-oate | C28H44 O6 |
| 35822-13-0 | Methyl 3-O,4-O,6-O-triacetyl-2-[(acetyloxy)mercurio(II)]-2-deoxy-β-D-glucopyranoside | C15H23HgO10 |
| 54277-95-1 | methylmercury sulfide | CH4 Hg S |
| 5453-05-4 | methyl 2-methyl-3-oxo-cyclopentene-1-carboxylate | C8H10 O3 |
| 171674-86-5 | Mimusopsin | C64H104O32 |
| 89590-95-4 | Mogroside IV | C54H92O24 |
| 181048-36-2 | MS 31-038 | C20H20 N4 O3 |
| 21211-23-4 | methyl 3-chlorobenzo[b]thiophene-2-carboxylate 1,1-dioxide | C10H7 Cl O4 S |
| 13088-83-0 | Methylphosphonothioic acid O-ethyl S-propyl ester | C6H15 O2 P S |
| 24138-27-0 | methyl (2S-cis)-6,6-dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | C9H11 Br2 N O3 S |
| 31848-01-8 | morclofone | C21H24 Cl N O5 |
| 159086-07-4 | methyl N-[(4E)-5-furan-2-yl-3-oxopent-4-en-1-yl]-L-tryptophanate | C21H22 N2 O4 |
| 86702-02-5 | Magnoshinin | C24H30O6 |
| 68555-63-5 | Maltol propionate | C9H10O4 |
| 56749-84-9 | magnapen | C35H36ClFN6O9S2 |
| 79522-53-5 | MB432 | C17H12 N2 O |
| 10228-54-3 | methyl butoxyacetate | C7H14 O3 |
| 14273-86-0 | Methyl 5-chloropentanoate | C6H11ClO2 |
| 91828-87-4 | MANT-GDP | C18H22N6O12P2 |
| 88108-86-5 | methanotetramethrin | C20H27 N O4 |
| 54598-77-5 | METHYL(AMIDINOTHIO)-2-CHLOROPROPIONATEHYDROCHLORIDE | C5H9 Cl N2 O2 S . Cl H |
| 107048-34-0 | Mastoparan 5 (9CI) | C48H91 N13 O10 |
| 25787-45-5 | methyl 2,5-di-O-acetyl-3-[acetyl(methyl)amino]-3-deoxypentofuranoside | C13H21 N O7 |
| 6131-30-2 | methyl 2-{[(3,6-dichloro-1-benzothiophen-2-yl)carbonyl]amino}-5-methylthiophene-3-carboxylate | C16H11Cl2NO3S2 |
| 99217-62-6 | mannose 6-sulfate | C6H12O9S |
| 131-70-4 | MONOBUTYL PHTHALATE | C12H14 O4 |
| 36120-75-9 | methyl(vinyl)phosphinic chloride | C3H6 Cl O P |
| 158681-49-3 | MS 209 | C72H74N6O18 |
| 94278-26-9 | METHYL 3-(FURFURYLTHIO)PROPIONATE | C9H12O3S |
| 93803-95-3 | methylcyclohexyl docosanoate | C29H56 O2 |
| 119986-67-3 | methyl 5-(3,4-dimethoxyphenyl)-2,3,4,5-tetrahydro-2-oxo-4-furancarboxylate | C14H16O6 |
| 110351-66-1 | Modiper A 110 |
| 122-89-4 | Mesulfamide | C7H10 N2 O5 S2 |
| 138842-67-8 | Mu-cron |
| 69927-23-7 | molecular chlorine, 2-propan-2-yloxypropane | C6H12 Cl2 O |
| 148024-86-6 | MAK3 protein |
| 14813-29-7 | MYRICETINHEXAACETATE | C27H22 O14 |
| 18598-71-5 | methyl L-argininate monohydrochloride | C7H16 N4 O2 . Cl H |
| 1528-30-9 | METHYLENECYCLOPENTANE | C6H10 |
| 132019-54-6 | Monatepil | C28H30FN3OS |
| 94349-53-8 | methyl 4-[[(3-amino-4-tolyl)sulphonyl]oxy]benzoate | C15H15 N O5 S |
| 10241-05-1 | MOLYBDENUM(V) CHLORIDE | MoCl5 |
| 74111-36-7 | Morphinan-3-ol, 6,14-endoetheno-4,5-alpha-epoxy-7-(2-hydroxy-5-methyl- 2-hexyl)-6-methoxy-17-methyl-, hydrochloride | C27H37 N O4 . Cl H |
| 13466-16-5 | Molybdate disodium | MoNa2O4 |
| 29878-00-0 | methyl borodiiodidate | CH3 B I2 O |
| 13573-12-1 | magnesium dimetaphosphate | HO3 P . 1/2 Mg |
| 35542-88-2 | MANGANESE(II) CYCLOHEXANEBUTYRATE | C10H18 O2 . 1/2 Mn |
- About us - Payment - Contact us - Links - Help Center - Disclaimer
- SiteMap | Product SiteMap | New CAS | Cas Database | Article Data | Product Name | Chemical Catalog | Manufacturers | VIP Product | Suppliers
- ©2008 LookChem.com,License:ICP NO.lookchem:Zhejiang16009103 complaints:service@lookchem.com
- [Hangzhou]86-0571-87562588,87562578,87562573 Our Legal adviser: Lawyer