The Acetic acid,2-(2-methoxyphenoxy)-, ethyl ester with CAS registry number of 13078-21-2 is also known as Ethyl (2-methoxyphenoxy)acetate. The IUPAC name is Ethyl 2-(2-methoxyphenoxy)acetate. Its EINECS registry number is 235-977-4. In addition, the formula is C₁₁H₁₄O₄ and the molecular weight is 210.23.

Physical properties about Acetic acid,2-(2-methoxyphenoxy)-, ethyl ester are: (1)ACD/LogP: 1.76; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.76; (4)ACD/LogD (pH 7.4): 1.76; (5)ACD/BCF (pH 5.5): 12.86; (6)ACD/BCF (pH 7.4): 12.86; (7)ACD/KOC (pH 5.5): 216.55; (8)ACD/KOC (pH 7.4): 216.55; (9)#H bond acceptors: 4; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 6; (12)Polar Surface Area: 44.76Ų; (13)Index of Refraction: 1.492; (14)Molar Refractivity: 55.28 cm³; (15)Molar Volume: 190.4 cm³; (16)Polarizability: 21.91×10^-24cm³; (17)Surface Tension: 35.4 dyne/cm; (18)Density: 1.103 g/cm³; (19)Flash Point: 118 °C; (20)Enthalpy of Vaporization: 51.74 kJ/mol; (21)Boiling Point: 278.7 °C at 760 mmHg; (22)Vapour Pressure: 0.00419 mmHg at 25 °C.

Uses of Acetic acid,2-(2-methoxyphenoxy)-, ethyl ester: it is used to produce (2-Methoxy-phenoxy)-acetic acid hydrazide. The reaction occurs with reagent Hydrazine hydrate and solvent Ethanol. Besides, the reaction needs other condition of heating for 12 hours. The yield is 65%.

You can still convert the following datas into molecular structure:
1. SMILES: O=C(OCC)COc1ccccc1OC
2. InChI: InChI=1/C11H14O4/c1-3-14-11(12)8-15-10-7-5-4-6-9(10)13-2/h4-7H,3,8H2,1-2H3
3. InChIKey: BZCGGCRVJFWCIW-UHFFFAOYAV
4. Std. InChI: InChI=1S/C11H14O4/c1-3-14-11(12)8-15-10-7-5-4-6-9(10)13-2/h4-7H,3,8H2,1-2H3
5. Std. InChIKey: BZCGGCRVJFWCIW-UHFFFAOYSA-N