The 1,3,5-Triazine,2,4,6-trihydrazinyl-, with the CAS registry number 10105-42-7, is also known as 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione trihydrazone. Its EINECS number is 233-288-3. This chemical's molecular formula is C₃H₉N₉ and molecular weight is 171.16. What's more, its systematic name is (2Z)-2,4,6-Trihydrazinylidene-1,3,5-triazinane.

Physical properties of 1,3,5-Triazine,2,4,6-trihydrazinyl- are: (1)# of Rule of 5 Violations: 1; (2)#H bond acceptors: 9; (3)#H bond donors: 9; (4)#Freely Rotating Bonds: 3; (5)Polar Surface Area: 151.23 Å²; (6)Index of Refraction: 2.107; (7)Molar Refractivity: 37.88 cm³; (8)Molar Volume: 70.9 cm³; (9)Polarizability: 15.01×10^-24cm³; (10)Surface Tension: 168.2 dyne/cm; (11)Density: 2.41 g/cm³; (12)Flash Point: 185.2 °C; (13)Enthalpy of Vaporization: 63.11 kJ/mol; (14)Boiling Point: 382.7 °C at 760 mmHg; (15)Vapour Pressure: 4.64E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1(=NC(=NC(=N1)NN)NN)NN
(2)InChI: InChI=1S/C3H9N9/c4-10-1-7-2(11-5)9-3(8-1)12-6/h4-6H2,(H3,7,8,9,10,11,12)
(3)InChIKey: CZGWDPMDAIPURF-UHFFFAOYSA-N