The 1,6-Naphthyridin-3-amine,5,6,7,8-tetrahydro-6-(phenylmethyl)- with CAS registry number of 214699-26-0 is also known as 6-Benzyl-5,6,7,8-tetrahydro-1,6-naphthyridin-3-amine. The IUPAC name is 6-Benzyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine. In addition, the formula is C₁₅H₁₇N₃ and the molecular weight is 239.32.

Physical properties about 1,6-Naphthyridin-3-amine,5,6,7,8-tetrahydro-6-(phenylmethyl)- are: (1)ACD/LogP: 1.26; (2)ACD/LogD (pH 5.5): 0.37; (3)ACD/LogD (pH 7.4): 1.23; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 4.93; (6)ACD/KOC (pH 5.5): 14.8; (7)ACD/KOC (pH 7.4): 106.54; (8)#H bond acceptors: 3; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.651; (12)Molar Refractivity: 73.48 cm³; (13)Molar Volume: 201.1 cm³; (14)Surface Tension: 58.5 dyne/cm; (15)Density: 1.189 g/cm³; (16)Flash Point: 208.9 °C; (17)Enthalpy of Vaporization: 67.59 kJ/mol; (18)Boiling Point: 421.8 °C at 760 mmHg; (19)Vapour Pressure: 2.53E-07 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. Canonical SMILES: C1CN(CC2=CC(=CN=C21)N)CC3=CC=CC=C3
2. InChI: InChI=1S/C15H17N3/c16-14-8-13-11-18(7-6-15(13)17-9-14)10-12-4-2-1-3-5-12/h1-5,8-9H,6-7,10-11,16H2
3. InChIKey: LZCBWYQNYNKFFL-UHFFFAOYSA-N?