The 1-Piperazineaceticacid, 4-(phenylmethyl)-, hydrazide, with the CAS registry number 24632-70-0, is also known as 4-Benzyl-1-piperazineacetic acid hydrazide. This chemical's molecular formula is C₁₃H₂₀N₄O and molecular weight is 248.3241. Its systematic name is called 2-(4-benzylpiperazin-1-yl)acetohydrazide. 

Physical properties of 1-Piperazineaceticacid, 4-(phenylmethyl)-, hydrazide: (1)ACD/LogP: -0.41; (2)ACD/LogD (pH 5.5): -1; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 3; (6)ACD/KOC (pH 7.4): 13; (7)#H bond acceptors: 5; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 5; (10)Index of Refraction: 1.58; (11)Molar Refractivity: 71.233 cm³; (12)Molar Volume: 214.066 cm³; (13)Surface Tension: 50.426 dyne/cm; (14)Density: 1.16 g/cm³; (15)Flash Point: 222.019 °C; (16)Enthalpy of Vaporization: 70.115 kJ/mol; (17)Boiling Point: 443.496 °C at 760 mmHg; (18)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(NN)CN2CCN(Cc1ccccc1)CC2
(2)InChI: InChI=1/C13H20N4O/c14-15-13(18)11-17-8-6-16(7-9-17)10-12-4-2-1-3-5-12/h1-5H,6-11,14H2,(H,15,18)
(3)InChIKey: HPORNZWVEBQIOT-UHFFFAOYAR