The 2,4(1H,3H)-Quinazolinedione,6-methyl-, with the CAS registry number 62484-16-6, is also known as NSC338219. This chemical's molecular formula is C₉H₈N₂O₂ and molecular weight is 176.17202. Its IUPAC name is called 6-methyl-1H-quinazoline-2,4-dione.

Physical properties of 2,4(1H,3H)-Quinazolinedione,6-methyl-: (1)ACD/LogP: 1.01; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.01; (4)ACD/LogD (pH 7.4): 1.01; (5)ACD/BCF (pH 5.5): 3.45; (6)ACD/BCF (pH 7.4): 3.45; (7)ACD/KOC (pH 5.5): 84.43; (8)ACD/KOC (pH 7.4): 84.39; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)Index of Refraction: 1.576; (12)Molar Refractivity: 45.59 cm³; (13)Molar Volume: 137.5 cm³; (14)Surface Tension: 45.6 dyne/cm; (15)Density: 1.28 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C2c1c(cccc1)NC(=O)N2CCO
(2)InChI: InChI=1/C10H10N2O3/c13-6-5-12-9(14)7-3-1-2-4-8(7)11-10(12)15/h1-4,13H,5-6H2,(H,11,15)
(3)InChIKey: DSUNWRHRAQZLNC-UHFFFAOYAL