The 3-Bromo-pyrazolo[1, 5-a]pyrimidine, with the CAS registry number 55405-67-9, is also known as Pyrazolo[1, 5-a]pyrimidine, 3-bromo-. This chemical's molecular formula is C₆H₄BrN₃ and molecular weight is 198.0200. What's more, its IUPAC name is 3-Bromopyrazolo[1, 5-a]pyrimidine.

Physical properties about 3-Bromo-pyrazolo[1, 5-a]pyrimidine are: (1)ACD/LogP: 1.08; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.08; (4)ACD/LogD (pH 7.4): 1.08; (5)ACD/BCF (pH 5.5): 3.92; (6)ACD/BCF (pH 7.4): 3.92; (7)ACD/KOC (pH 5.5): 92.56; (8)ACD/KOC (pH 7.4): 92.56; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 30.19 Å²; (13)Index of Refraction: 1.751; (14)Molar Refractivity: 42.71 cm³; (15)Molar Volume: 104.6 cm³; (16)Polarizability: 16.93×10^-24 cm³; (17)Surface Tension: 61.8 dyne/cm; (18)Density: 1.89 g/cm³.

You can still convert the following datas into molecular structure:
(1) SMILES: c1cnc2c(cnn2c1)Br
(2) InChI: InChI=1/C6H4BrN3/c7-5-4-9-10-3-1-2-8-6(5)10/h1-4H
(3) InChIKey: MFJWRPLBWPDHGV-UHFFFAOYAT