The 4-Morpholinecarbonyl chloride with the CAS number 15159-40-7 is also called 4-Morpholinecarboxylic acid chloride. Both the systematic name and IUPAC name are morpholine-4-carbonyl chloride. Its EINECS registry number is 239-213-0. The molecular formula is C₅H₈ClNO₂. This chemical belongs to the following product categories: (1)Acidhalide; (2)Phosgene Derivatives; (3)Building Blocks; (4)Heterocyclic Building Blocks; (5)Morpholines.

The properties of the chemical are: (1)ACD/LogP: -0.54; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.54; (4)ACD/LogD (pH 7.4): -0.54; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 12.17; (8)ACD/KOC (pH 7.4): 12.17; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 29.54Ų; (13)Index of Refraction: 1.487; (14)Molar Refractivity: 33.04 cm³; (15)Molar Volume: 114.6 cm³; (16)Polarizability: 13.09×10^-24cm³; (17)Surface Tension: 41.6 dyne/cm; (18)Enthalpy of Vaporization: 47.56 kJ/mol; (19)Vapour Pressure: 0.0418 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: ClC(=O)N1CCOCC1
(2)InChI: InChI=1/C5H8ClNO2/c6-5(8)7-1-3-9-4-2-7/h1-4H2
(3)InChIKey: XMWFMEYDRNJSOO-UHFFFAOYAL