The 4-Nitroisatin, with the CAS registry number 61394-93-2, is also known as 4-Nitro-2,3-dioxyindole. This chemical's molecular formula is C₈H₄N₂O₄ and molecular weight is 192.13. What's more, its systematic name is 4-Nitro-1H-indole-2,3-dione. 

Physical properties of 4-Nitroisatin are: (1)ACD/LogP: 0.289; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.29; (4)ACD/LogD (pH 7.4): 0.24; (5)ACD/BCF (pH 5.5): 1.00; (6)ACD/BCF (pH 7.4): 1.00; (7)ACD/KOC (pH 5.5): 34.17; (8)ACD/KOC (pH 7.4): 30.59; (9)#H bond acceptors: 6; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 91.99 Å²; (13)Index of Refraction: 1.658; (14)Molar Refractivity: 43.97 cm³; (15)Molar Volume: 119.394 cm³; (16)Polarizability: 17.431×10^-24cm³; (17)Surface Tension: 72.3 dyne/cm; (18)Density: 1.609 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: [O-][N+](=O)c1cccc2c1C(=O)C(=O)N2
(2)Std. InChI: InChI=1S/C8H4N2O4/c11-7-6-4(9-8(7)12)2-1-3-5(6)10(13)14/h1-3H,(H,9,11,12)
(3)Std. InChIKey: TYITZWXVYYSISG-UHFFFAOYSA-N