The Cobalt, [5, 10, 15, 20-tetraphenyl-21H, 23H-porphinato(2-)-kN21, kN22, kN23, kN24]-, (SP-4-1)- (9CI), with the CAS registry number 14172-90-8, is also known as Cobalt TPP and 5, 10, 15, 20-Tetraphenylporphyrinatocobalt. Its EINECS registry number is 238-018-8. This chemical's molecular formula is C₄₄H₂₈CoN₄ and molecular weight is 671.65. What's more, its systematic name is Cobalt(2+) 5, 10, 15, 20-tetraphenylporphine-21, 23-diide. Besides, Cobalt, [5, 10, 15, 20-tetraphenyl-21H, 23H-porphinato(2-)-kN21, kN22, kN23, kN24]-, (SP-4-1)- (9CI) is a brown crystals or powder. And it is incompatible with strong oxidizing agents.

You can still convert the following datas into molecular structure:
(1) SMILES: c1ccc(cc1)/c/2c\3/nc(/c(c/4\[n-]/c(c(\c5n/c(c(\c6[n-]c2cc6)/c7ccccc7)/C=C5)/c8ccccc8)/cc4)/c9ccccc9)C=C3.[Co+2]
(2) InChI: InChI=1/C44H28N4.Co/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;/h1-28H;/q-2;+2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-;
(3) InChIKey: LSZLYWSRWXFMOI-DAJBKUBHBF