The 5-Thiazolecarboxamide,2,4-dimethyl-, with the CAS registry number 66806-33-5, is also known as 2,4-Dimethyl-thiazole-5-carboxylic acid amide. This chemical's molecular formula is C₆H₈N₂OS and molecular weight is 156.2055. Its systematic name is called 2,4-dimethyl-1,3-thiazole-5-carboxamide. This chemical should be stored in dry and cool place.

Physical properties of 5-Thiazolecarboxamide,2,4-dimethyl-: (1)ACD/LogP: 0.08; (2)ACD/LogD (pH 5.5): 0.08; (3)ACD/LogD (pH 7.4): 0.08; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 26.44; (7)ACD/KOC (pH 7.4): 26.47; (8)#H bond acceptors: 3; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.584; (12)Molar Refractivity: 41.3 cm³; (13)Molar Volume: 123.3 cm³; (14)Surface Tension: 53.8 dyne/cm; (15)Density: 1.266 g/cm³; (16)Flash Point: 133.6 °C; (17)Enthalpy of Vaporization: 53.71 kJ/mol; (18)Boiling Point: 297.3 °C at 760 mmHg; (19)Vapour Pressure: 0.00136 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(c1sc(nc1C)C)N
(2)InChI: InChI=1/C6H8N2OS/c1-3-5(6(7)9)10-4(2)8-3/h1-2H3,(H2,7,9)
(3)InChIKey: BEVWMRQFVUOPJT-UHFFFAOYAT