The Phosphine oxide,bis(3,5-dimethylphenyl)- has the CAS registry number 187344-92-9. This chemical's molecular formula is C₁₆H₁₉OP and molecular weight is 258.30. What's more, its systematic name is Bis(3,5-dimethylphenyl)phosphane oxide.

Physical properties of Phosphine oxide,bis(3,5-dimethylphenyl)- are: (1)ACD/LogP: 2.86; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3; (4)ACD/LogD (pH 7.4): 3; (5)ACD/BCF (pH 5.5): 142; (6)ACD/BCF (pH 7.4): 142; (7)ACD/KOC (pH 5.5): 1207; (8)ACD/KOC (pH 7.4): 1207; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 40.54 Å²; (13)Flash Point: 204.691 °C; (14)Enthalpy of Vaporization: 64.191 kJ/mol; (15)Boiling Point: 414.844 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: Cc1cc(cc(C)c1)P(=O)c2cc(C)cc(C)c2
(2)InChI: InChI=1/C16H19OP/c1-11-5-12(2)8-15(7-11)18(17)16-9-13(3)6-14(4)10-16/h5-10,18H,1-4H3
(3)InChIKey: AWAYSUMOANJULO-UHFFFAOYSA-N