The DL-Glutamic acid hydrochloride wi th the CAS number 15767-75-6 is also called Glutamic acid,hydrochloride (1:1). The IUPAC name is 2-aminopentanedioic acid hydrochloride. Its EINECS registry number is 239-858-8. The molecular formula is C₅H₉NO₄^.HCl.

The properties of the chemical are: (1)ACD/LogP: -1.44; (2)#of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -4.7; (4)ACD/LogD (pH 7.4): -4.93; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 5; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 55.84 Å²; (13)Enthalpy of Vaporization: 63.39 kJ/mol; (14)Vapour Pressure: 2.55×10^-5 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)CCC(N)C(=O)O.Cl
(2)InChI: InChI=1/C5H9NO4.ClH/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H
(3)InChIKey: RPAJSBKBKSSMLJ-UHFFFAOYAG