The Manganese oxalate, with the CAS registry number 640-67-5, is also known as Ethanedioic acid, manganese(2+) salt (1:1). Its EINECS registry number is 211-367-3. This chemical's molecular formula is C₂MnO₄ and molecular weight is 142.96. Its IUPAC name is called manganese(2+); oxalate.

Physical properties of Manganese oxalate: (1)ACD/LogP: -1.19; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -5.7; (4)ACD/LogD (pH 7.4): -5.94; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Flash Point: 188.8 °C; (13)Enthalpy of Vaporization: 67.15 kJ/mol; (14)Boiling Point: 365.1 °C at 760 mmHg; (15)Vapour Pressure: 2.51E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C(=O)(C(=O)[O-])[O-].[Mn+2]
(2)InChI: InChI=1S/C2H2O4.Mn/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2
(3)InChIKey: RGVLTEMOWXGQOS-UHFFFAOYSA-L