The CAS registry number of Pyridine,2-bromo-6-chloro-3-nitro- is 91678-23-8. This chemical's molecular formula is C₅H₂BrClN₂O₂ and molecular weight is 237.43858. Its systematic name is called 2-Bromo-6-chloro-3-nitropyridine.

Physical properties of Pyridine,2-bromo-6-chloro-3-nitro-: (1)ACD/LogP: 1.85; (2)ACD/LogD (pH 5.5): 1.85; (3)ACD/LogD (pH 7.4): 1.85; (4)ACD/BCF (pH 5.5): 14.93; (5)ACD/BCF (pH 7.4): 14.93; (6)ACD/KOC (pH 5.5): 240.95; (7)ACD/KOC (pH 7.4): 240.95; (8)#H bond acceptors: 4; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.627; (11)Molar Refractivity: 43.47 cm³; (12)Molar Volume: 122.6 cm³; (13)Surface Tension: 61.3 dyne/cm; (14)Density: 1.936 g/cm³; (15)Flash Point: 121.5 °C; (16)Enthalpy of Vaporization: 49.51 kJ/mol; (17)Boiling Point: 277.2 °C at 760 mmHg; (18)Vapour Pressure: 0.00772 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cc(nc(c1[N+](=O)[O-])Br)Cl
(2)InChI: InChI=1/C5H2BrClN2O2/c6-5-3(9(10)11)1-2-4(7)8-5/h1-2H
(3)InChIKey: WISCKHBEOBONJA-UHFFFAOYAG